Fmoc-D-Trp(Boc)-OH CAS NO.163619-04-3

Quality Contral:
1. HPLC
2. GC
3. TLC
4. Chemical titration
5. Karl Fischer Water Titration
6. Specific Optical Rotation test
7. Melting point test

Company Profile
Company Name: Chengdu ChengNuo New –Tech Co.,Ltd.
Main Fields: Peptide Synthesis, Amino Acid , Pharmaceutical Pre-manufactured Catalogs and Oilfield Chemicals.

Specification of Fmoc-D-Trp(Boc)-OH(163619-04-3)
CAS No:163619-04-3       

Purity(HPLC): ≥98.0%

Appearance:  off-white powder

[α]20/D=+19±2.5°,C=1 in DMF

Solubility: 1mmol in 2ml DMF clearly soluble

TLC: One Spot

Loss on drying: ≤0.5%

Other information
Name:Fmoc-D-Trp(Boc)-OH   
Synonyms:Nα-Fmoc-N(in)-Boc-D-Tryptophan
Big Type: Amino acids and derivatives(Fmoc- amino acids、Boc- amino acids、Cbz- amino acids、N-Acetyl amino acids、Amino acids esters、Amino acids amides、Amino acid alcohols、N-Methyl amino acids)
Small Type ：Tryptophan

Application
1. It's a kind of nutritional supplement.
2. It can improve the aerobic metabolism of the muscle and greatly enhance muscle strength and endurance from diet alone.
3. It can be used as nutrition enhancer.
4. It's one of the most popular and effective nutritional supplements as well as the indispensable product for bodybuilders.
5. It is also widely used by other athletes, such as football players, basketball players and so on.